C14H17F3N2O4 — CID 158628161
2-hydroxy-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 158628161) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-hydroxy-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-hydroxy-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158628161 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-hydroxy-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CO)NC[C@@H]1Cc2ccccc2CN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16N2O2.C2HF3O2/c15-8-12(16)14-7-11-5-9-3-1-2-4-10(9)6-13-11;3-2(4,5)1(6)7/h1-4,11,13,15H,5-8H2,(H,14,16);(H,6,7)/t11-;/m0./s1 |
| InChIKey | XGKGSOBJJFMIEL-MERQFXBCSA-N |
| XLogP | 0.44 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |