C29H41BN2O5 — CID 158629156
methyl (3S)-4-methyl-3-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidine-1-carbonyl]pentanoate (PubChem CID 158629156) has the molecular formula C29H41BN2O5 and a molecular weight of 508.47 g/mol. Its IUPAC name is methyl (3S)-4-methyl-3-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidine-1-carbonyl]pentanoate.
| Compound Name | methyl (3S)-4-methyl-3-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidine-1-carbonyl]pentanoate |
|---|---|
| PubChem CID | 158629156 |
| Molecular Formula | C29H41BN2O5 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | methyl (3S)-4-methyl-3-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidine-1-carbonyl]pentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1CCCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C(C)C |
| InChI | InChI=1S/C29H41BN2O5/c1-19(2)23(17-26(33)35-7)27(34)32-15-9-8-10-25(32)24-16-21(18-31-24)20-11-13-22(14-12-20)30-36-28(3,4)29(5,6)37-30/h11-14,18-19,23,25H,8-10,15-17H2,1-7H3/t23-,25-/m0/s1 |
| InChIKey | BSBVMDXUAOSDMF-ZCYQVOJMSA-N |
| XLogP | 4.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|