C27H37BN2O5 — CID 158646780
methyl (3R)-3-methyl-4-oxo-4-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidin-1-yl]butanoate (PubChem CID 158646780) has the molecular formula C27H37BN2O5 and a molecular weight of 480.41 g/mol. Its IUPAC name is methyl (3R)-3-methyl-4-oxo-4-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidin-1-yl]butanoate.
| Compound Name | methyl (3R)-3-methyl-4-oxo-4-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 158646780 |
| Molecular Formula | C27H37BN2O5 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | methyl (3R)-3-methyl-4-oxo-4-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]piperidin-1-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)C(=O)N1CCCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C27H37BN2O5/c1-18(15-24(31)33-6)25(32)30-14-8-7-9-23(30)22-16-20(17-29-22)19-10-12-21(13-11-19)28-34-26(2,3)27(4,5)35-28/h10-13,17-18,23H,7-9,14-16H2,1-6H3/t18-,23+/m1/s1 |
| InChIKey | WEMURZPMOMBNSP-JPYJTQIMSA-N |
| XLogP | 3.75 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|