C25H35BN2O3 — CID 158654835
3-methyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 158654835) has the molecular formula C25H35BN2O3 and a molecular weight of 422.38 g/mol. Its IUPAC name is 3-methyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 158654835 |
| Molecular Formula | C25H35BN2O3 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-methyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C25H35BN2O3/c1-17(2)14-23(29)28-13-7-8-22(28)21-15-19(16-27-21)18-9-11-20(12-10-18)26-30-24(3,4)25(5,6)31-26/h9-12,16-17,22H,7-8,13-15H2,1-6H3/t22-/m0/s1 |
| InChIKey | QLLAPEPOZVJPLU-QFIPXVFZSA-N |
| XLogP | 4.21 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|