C26H37BN2O3 — CID 158053786
(2S)-2,3-dimethyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 158053786) has the molecular formula C26H37BN2O3 and a molecular weight of 436.41 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2,3-dimethyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 158053786 |
| Molecular Formula | C26H37BN2O3 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | (2S)-2,3-dimethyl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)[C@H](C)C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C26H37BN2O3/c1-17(2)18(3)24(30)29-14-8-9-23(29)22-15-20(16-28-22)19-10-12-21(13-11-19)27-31-25(4,5)26(6,7)32-27/h10-13,16-18,23H,8-9,14-15H2,1-7H3/t18-,23-/m0/s1 |
| InChIKey | YFCNVGKNYWDRGB-MBSDFSHPSA-N |
| XLogP | 4.45 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|