C27H37BN2O5 — CID 158757290
methyl (3S)-4-methyl-3-[(3S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carbonyl]pentanoate (PubChem CID 158757290) has the molecular formula C27H37BN2O5 and a molecular weight of 480.41 g/mol. Its IUPAC name is methyl (3S)-4-methyl-3-[(3S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carbonyl]pentanoate.
| Compound Name | methyl (3S)-4-methyl-3-[(3S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carbonyl]pentanoate |
|---|---|
| PubChem CID | 158757290 |
| Molecular Formula | C27H37BN2O5 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | methyl (3S)-4-methyl-3-[(3S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carbonyl]pentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1C2CC2C[C@H]1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1)C(C)C |
| InChI | InChI=1S/C27H37BN2O5/c1-15(2)19(14-24(31)33-7)25(32)30-22-12-17(22)13-23(30)21-11-16-10-18(8-9-20(16)29-21)28-34-26(3,4)27(5,6)35-28/h8-10,15,17,19,22-23H,11-14H2,1-7H3/t17?,19-,22?,23-/m0/s1 |
| InChIKey | VCDXHORKXPGSEB-YNYGXFLOSA-N |
| XLogP | 3.44 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|