C53H67N3O3 — CID 158629646
2-(1-butoxypentyl)-6-phenylpyridine;2-(1-methoxy-2-methylpropyl)-6-phenylpyridine;2-(1-methoxypentyl)-6-phenylpyridine (PubChem CID 158629646) has the molecular formula C53H67N3O3 and a molecular weight of 794.14 g/mol. Its IUPAC name is 2-(1-butoxypentyl)-6-phenylpyridine;2-(1-methoxy-2-methylpropyl)-6-phenylpyridine;2-(1-methoxypentyl)-6-phenylpyridine.
| Compound Name | 2-(1-butoxypentyl)-6-phenylpyridine;2-(1-methoxy-2-methylpropyl)-6-phenylpyridine;2-(1-methoxypentyl)-6-phenylpyridine |
|---|---|
| PubChem CID | 158629646 |
| Molecular Formula | C53H67N3O3 |
| Molecular Weight | 794.14 g/mol |
| Exact Mass | 793.52 |
| IUPAC Name | 2-(1-butoxypentyl)-6-phenylpyridine;2-(1-methoxy-2-methylpropyl)-6-phenylpyridine;2-(1-methoxypentyl)-6-phenylpyridine |
| SMILES | CCCCC(OC)c1cccc(-c2ccccc2)n1.CCCCOC(CCCC)c1cccc(-c2ccccc2)n1.COC(c1cccc(-c2ccccc2)n1)C(C)C |
| InChI | InChI=1S/C20H27NO.C17H21NO.C16H19NO/c1-3-5-15-20(22-16-6-4-2)19-14-10-13-18(21-19)17-11-8-7-9-12-17;1-3-4-13-17(19-2)16-12-8-11-15(18-16)14-9-6-5-7-10-14;1-12(2)16(18-3)15-11-7-10-14(17-15)13-8-5-4-6-9-13/h7-14,20H,3-6,15-16H2,1-2H3;5-12,17H,3-4,13H2,1-2H3;4-12,16H,1-3H3 |
| InChIKey | HZAKNQGKECHJEN-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.14 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|