C31H47B2N5O5 — CID 158634787
1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]morpholine (PubChem CID 158634787) has the molecular formula C31H47B2N5O5 and a molecular weight of 591.37 g/mol. Its IUPAC name is 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]morpholine.
| Compound Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 158634787 |
| Molecular Formula | C31H47B2N5O5 |
| Molecular Weight | 591.37 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]morpholine |
| SMILES | CC1(C)OB(c2cnn(CCN3CCOCC3)c2)OC1(C)C.CC1(C)OB(c2cnn(Cc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C16H21BN2O2.C15H26BN3O3/c1-15(2)16(3,4)21-17(20-15)14-10-18-19(12-14)11-13-8-6-5-7-9-13;1-14(2)15(3,4)22-16(21-14)13-11-17-19(12-13)6-5-18-7-9-20-10-8-18/h5-10,12H,11H2,1-4H3;11-12H,5-10H2,1-4H3 |
| InChIKey | HZQFZUMKWOQTLG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|