C24H20N2O8S2 — CID 158634865
4-(3-amino-2-methoxyphenyl)thiophene-2-carboxylic acid;4-(2-methoxy-3-nitrophenyl)thiophene-2-carboxylic acid (PubChem CID 158634865) has the molecular formula C24H20N2O8S2 and a molecular weight of 528.56 g/mol. Its IUPAC name is 4-(3-amino-2-methoxyphenyl)thiophene-2-carboxylic acid;4-(2-methoxy-3-nitrophenyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(3-amino-2-methoxyphenyl)thiophene-2-carboxylic acid;4-(2-methoxy-3-nitrophenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 158634865 |
| Molecular Formula | C24H20N2O8S2 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 4-(3-amino-2-methoxyphenyl)thiophene-2-carboxylic acid;4-(2-methoxy-3-nitrophenyl)thiophene-2-carboxylic acid |
| SMILES | COc1c(-c2csc(C(=O)O)c2)cccc1[N+](=O)[O-].COc1c(N)cccc1-c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C12H9NO5S.C12H11NO3S/c1-18-11-8(3-2-4-9(11)13(16)17)7-5-10(12(14)15)19-6-7;1-16-11-8(3-2-4-9(11)13)7-5-10(12(14)15)17-6-7/h2-6H,1H3,(H,14,15);2-6H,13H2,1H3,(H,14,15) |
| InChIKey | HZQLGHYLHXGMOL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|