C26H24N2O10 — CID 159745020
5-(3-amino-2-methoxyphenyl)-2-methylfuran-3-carboxylic acid;5-(2-methoxy-3-nitrophenyl)-2-methylfuran-3-carboxylic acid (PubChem CID 159745020) has the molecular formula C26H24N2O10 and a molecular weight of 524.48 g/mol. Its IUPAC name is 5-(3-amino-2-methoxyphenyl)-2-methylfuran-3-carboxylic acid;5-(2-methoxy-3-nitrophenyl)-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-(3-amino-2-methoxyphenyl)-2-methylfuran-3-carboxylic acid;5-(2-methoxy-3-nitrophenyl)-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 159745020 |
| Molecular Formula | C26H24N2O10 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 5-(3-amino-2-methoxyphenyl)-2-methylfuran-3-carboxylic acid;5-(2-methoxy-3-nitrophenyl)-2-methylfuran-3-carboxylic acid |
| SMILES | COc1c(-c2cc(C(=O)O)c(C)o2)cccc1[N+](=O)[O-].COc1c(N)cccc1-c1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C13H11NO6.C13H13NO4/c1-7-9(13(15)16)6-11(20-7)8-4-3-5-10(14(17)18)12(8)19-2;1-7-9(13(15)16)6-11(18-7)8-4-3-5-10(14)12(8)17-2/h3-6H,1-2H3,(H,15,16);3-6H,14H2,1-2H3,(H,15,16) |
| InChIKey | NCXZGPISIRUMLG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 188.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|