C23H31IN2OSi — CID 158635751
2-[2-dimethylsilyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-(3-iodo-4-methylphenyl)ethanone (PubChem CID 158635751) has the molecular formula C23H31IN2OSi and a molecular weight of 506.50 g/mol. Its IUPAC name is 2-[2-dimethylsilyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-(3-iodo-4-methylphenyl)ethanone.
| Compound Name | 2-[2-dimethylsilyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-(3-iodo-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 158635751 |
| Molecular Formula | C23H31IN2OSi |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 2-[2-dimethylsilyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1-(3-iodo-4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccc(CN3CCN(C)CC3)cc2[SiH](C)C)cc1I |
| InChI | InChI=1S/C23H31IN2OSi/c1-17-5-7-19(14-21(17)24)22(27)15-20-8-6-18(13-23(20)28(3)4)16-26-11-9-25(2)10-12-26/h5-8,13-14,28H,9-12,15-16H2,1-4H3 |
| InChIKey | GRZGPNIJKPPVAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|