About oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine
oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine (PubChem CID 158637201) has the molecular formula C16H22N2O6
and a molecular weight of 338.36 g/mol. Its IUPAC name is oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine.
Molecular Properties
| Compound Name | oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine |
| PubChem CID | 158637201 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine |
| SMILES | C#CCN.C#CCNC(=O)CCCC(=O)O.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C8H11NO3.C5H6O3.C3H5N/c1-2-6-9-7(10)4-3-5-8(11)12;6-4-2-1-3-5(7)8-4;1-2-3-4/h1H,3-6H2,(H,9,10)(H,11,12);1-3H2;1H,3-4H2 |
| InChIKey | HZXNFDRFVZFJAF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine?
The IUPAC name of oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine (CID 158637201) is oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine.
What is the SMILES notation for oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine?
The canonical SMILES for oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine is C#CCN.C#CCNC(=O)CCCC(=O)O.O=C1CCCC(=O)O1.
What is the InChIKey of oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine?
The InChIKey is HZXNFDRFVZFJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.C5H6O3.C3H5N/c1-2-6-9-7(10)4-3-5-8(11)12;6-4-2-1-3-5(7)8-4;1-2-3-4/h1H,3-6H2,(H,9,10)(H,11,12);1-3H2;1H,3-4H2.
What are the key properties of oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine?
oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine has a molecular weight of 338.36 g/mol, XLogP of -0.19, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,6-dione;5-oxo-5-(prop-2-ynylamino)pentanoic acid;prop-2-yn-1-amine is sourced from PubChem (CID 158637201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).