C26H24FN6O3S- — CID 158637431
benzenesulfinate;4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine (PubChem CID 158637431) has the molecular formula C26H24FN6O3S- and a molecular weight of 519.58 g/mol. Its IUPAC name is benzenesulfinate;4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | benzenesulfinate;4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 158637431 |
| Molecular Formula | C26H24FN6O3S- |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | benzenesulfinate;4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Fc1ccc(-c2nc3occn3c2-c2ccnc(N[C@@H]3CCCNC3)n2)cc1.O=S([O-])c1ccccc1 |
| InChI | InChI=1S/C20H19FN6O.C6H6O2S/c21-14-5-3-13(4-6-14)17-18(27-10-11-28-20(27)26-17)16-7-9-23-19(25-16)24-15-2-1-8-22-12-15;7-9(8)6-4-2-1-3-5-6/h3-7,9-11,15,22H,1-2,8,12H2,(H,23,24,25);1-5H,(H,7,8)/p-1/t15-;/m1./s1 |
| InChIKey | WNBBRQNHNMJECM-XFULWGLBSA-M |
| XLogP | 4.28 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|