About 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate
1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate (PubChem CID 158646548) has the molecular formula C19H24N2O6
and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate.
Molecular Properties
| Compound Name | 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate |
| PubChem CID | 158646548 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate |
| SMILES | C.CC(=O)c1ccc(NO)cc1.COC(=O)N(O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C10H11NO4.C8H9NO2.CH4/c1-7(12)8-3-5-9(6-4-8)11(14)10(13)15-2;1-6(10)7-2-4-8(9-11)5-3-7;/h3-6,14H,1-2H3;2-5,9,11H,1H3;1H4 |
| InChIKey | IBASDCZJOSZTFP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate?
The IUPAC name of 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate (CID 158646548) is 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate.
What is the SMILES notation for 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate?
The canonical SMILES for 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate is C.CC(=O)c1ccc(NO)cc1.COC(=O)N(O)c1ccc(C(C)=O)cc1.
What is the InChIKey of 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate?
The InChIKey is IBASDCZJOSZTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C8H9NO2.CH4/c1-7(12)8-3-5-9(6-4-8)11(14)10(13)15-2;1-6(10)7-2-4-8(9-11)5-3-7;/h3-6,14H,1-2H3;2-5,9,11H,1H3;1H4.
What are the key properties of 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate?
1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate has a molecular weight of 376.41 g/mol, XLogP of 4.18, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(hydroxyamino)phenyl]ethanone;methane;methyl N-(4-acetylphenyl)-N-hydroxycarbamate is sourced from PubChem (CID 158646548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).