About N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane
N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane (PubChem CID 160519414) has the molecular formula C15H18I2N2O3
and a molecular weight of 528.13 g/mol. Its IUPAC name is N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane.
Molecular Properties
| Compound Name | N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane |
| PubChem CID | 160519414 |
| Molecular Formula | C15H18I2N2O3 |
| Molecular Weight | 528.13 g/mol |
| Exact Mass | 527.94 |
| IUPAC Name | N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane |
| SMILES | C.CC(=O)N(O)c1ccc(I)cc1.ONc1ccc(I)cc1 |
| InChI | InChI=1S/C8H8INO2.C6H6INO.CH4/c1-6(11)10(12)8-4-2-7(9)3-5-8;7-5-1-3-6(8-9)4-2-5;/h2-5,12H,1H3;1-4,8-9H;1H4 |
| InChIKey | QUBRMMALDGOYLJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane?
The IUPAC name of N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane (CID 160519414) is N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane.
What is the SMILES notation for N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane?
The canonical SMILES for N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane is C.CC(=O)N(O)c1ccc(I)cc1.ONc1ccc(I)cc1.
What is the InChIKey of N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane?
The InChIKey is QUBRMMALDGOYLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO2.C6H6INO.CH4/c1-6(11)10(12)8-4-2-7(9)3-5-8;7-5-1-3-6(8-9)4-2-5;/h2-5,12H,1H3;1-4,8-9H;1H4.
What are the key properties of N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane?
N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane has a molecular weight of 528.13 g/mol, XLogP of 4.76, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N-(4-iodophenyl)acetamide;N-(4-iodophenyl)hydroxylamine;methane is sourced from PubChem (CID 160519414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).