C17H25N6O9P — CID 158647942
[(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] (E,2S)-2-amino-4-ethoxybut-3-enoate (PubChem CID 158647942) has the molecular formula C17H25N6O9P and a molecular weight of 488.39 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] (E,2S)-2-amino-4-ethoxybut-3-enoate.
| Compound Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] (E,2S)-2-amino-4-ethoxybut-3-enoate |
|---|---|
| PubChem CID | 158647942 |
| Molecular Formula | C17H25N6O9P |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] (E,2S)-2-amino-4-ethoxybut-3-enoate |
| SMILES | CCO/C=C/[C@H](N)C(=O)O[C@@H]1C(O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)OC |
| InChI | InChI=1S/C17H25N6O9P/c1-3-29-5-4-9(18)17(25)32-13-10(6-30-33(26,27)28-2)31-16(12(13)24)23-8-22-11-14(19)20-7-21-15(11)23/h4-5,7-10,12-13,16,24H,3,6,18H2,1-2H3,(H,26,27)(H2,19,20,21)/b5-4+/t9-,10+,12?,13-,16+/m0/s1 |
| InChIKey | WPBIDNPTWHXEGC-GKJDSGLJSA-N |
| XLogP | -0.78 |
| TPSA | 216.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|