C23H30N5O8P — CID 167649906
[(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2,3,4,5,6-pentamethylbenzoate (PubChem CID 167649906) has the molecular formula C23H30N5O8P and a molecular weight of 535.49 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2,3,4,5,6-pentamethylbenzoate.
| Compound Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2,3,4,5,6-pentamethylbenzoate |
|---|---|
| PubChem CID | 167649906 |
| Molecular Formula | C23H30N5O8P |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2,3,4,5,6-pentamethylbenzoate |
| SMILES | COP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)[C@H]1OC(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C23H30N5O8P/c1-10-11(2)13(4)16(14(5)12(10)3)23(30)36-19-15(7-34-37(31,32)33-6)35-22(18(19)29)28-9-27-17-20(24)25-8-26-21(17)28/h8-9,15,18-19,22,29H,7H2,1-6H3,(H,31,32)(H2,24,25,26)/t15-,18?,19+,22-/m1/s1 |
| InChIKey | VTPORIYSATUQND-KBAATXCXSA-N |
| XLogP | 2.20 |
| TPSA | 181.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|