C42H41Cl3I2N4 — CID 158656158
6-chloro-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-2,3-dimethylquinoline;4,6-dichloro-2,3-dimethylquinoline;6-iodo-3,3-dimethyl-1,2-dihydroindole (PubChem CID 158656158) has the molecular formula C42H41Cl3I2N4 and a molecular weight of 961.98 g/mol. Its IUPAC name is 6-chloro-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-2,3-dimethylquinoline;4,6-dichloro-2,3-dimethylquinoline;6-iodo-3,3-dimethyl-1,2-dihydroindole.
| Compound Name | 6-chloro-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-2,3-dimethylquinoline;4,6-dichloro-2,3-dimethylquinoline;6-iodo-3,3-dimethyl-1,2-dihydroindole |
|---|---|
| PubChem CID | 158656158 |
| Molecular Formula | C42H41Cl3I2N4 |
| Molecular Weight | 961.98 g/mol |
| Exact Mass | 960.05 |
| IUPAC Name | 6-chloro-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-2,3-dimethylquinoline;4,6-dichloro-2,3-dimethylquinoline;6-iodo-3,3-dimethyl-1,2-dihydroindole |
| SMILES | CC1(C)CNc2cc(I)ccc21.Cc1nc2ccc(Cl)cc2c(Cl)c1C.Cc1nc2ccc(Cl)cc2c(N2CC(C)(C)c3ccc(I)cc32)c1C |
| InChI | InChI=1S/C21H20ClIN2.C11H9Cl2N.C10H12IN/c1-12-13(2)24-18-8-5-14(22)9-16(18)20(12)25-11-21(3,4)17-7-6-15(23)10-19(17)25;1-6-7(2)14-10-4-3-8(12)5-9(10)11(6)13;1-10(2)6-12-9-5-7(11)3-4-8(9)10/h5-10H,11H2,1-4H3;3-5H,1-2H3;3-5,12H,6H2,1-2H3 |
| InChIKey | ICDWUHSADNQEEE-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.98 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|