C20H20FNO3 — CID 158658145
2-(1-benzyl-2-methylindol-4-yl)oxy-2-fluorobutanoic acid (PubChem CID 158658145) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-(1-benzyl-2-methylindol-4-yl)oxy-2-fluorobutanoic acid.
| Compound Name | 2-(1-benzyl-2-methylindol-4-yl)oxy-2-fluorobutanoic acid |
|---|---|
| PubChem CID | 158658145 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(1-benzyl-2-methylindol-4-yl)oxy-2-fluorobutanoic acid |
| SMILES | CCC(F)(Oc1cccc2c1cc(C)n2Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H20FNO3/c1-3-20(21,19(23)24)25-18-11-7-10-17-16(18)12-14(2)22(17)13-15-8-5-4-6-9-15/h4-12H,3,13H2,1-2H3,(H,23,24) |
| InChIKey | ICKIFNUJLGMIKM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |