C19H15F3N4O2 — CID 118159933
(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl) 2,2,2-trifluoroacetate (PubChem CID 118159933) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is (5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl) 2,2,2-trifluoroacetate.
| Compound Name | (5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118159933 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl) 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(cc(OC(=O)C(F)(F)F)c3nnc(C)n32)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H15F3N4O2/c1-11-8-15-14(25(11)10-13-6-4-3-5-7-13)9-16(28-18(27)19(20,21)22)17-24-23-12(2)26(15)17/h3-9H,10H2,1-2H3 |
| InChIKey | AGMHJSZALYXFJQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |