C18H16F2N6O — CID 118159652
[5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea (PubChem CID 118159652) has the molecular formula C18H16F2N6O and a molecular weight of 370.36 g/mol. Its IUPAC name is [5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea.
| Compound Name | [5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea |
|---|---|
| PubChem CID | 118159652 |
| Molecular Formula | C18H16F2N6O |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea |
| SMILES | Cc1cc2c(cc(NC(N)=O)c3nnc(C)n32)n1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2N6O/c1-9-5-16-15(25(9)8-11-3-4-12(19)13(20)6-11)7-14(22-18(21)27)17-24-23-10(2)26(16)17/h3-7H,8H2,1-2H3,(H3,21,22,27) |
| InChIKey | IZWLKNONDJYFBO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |