C18H17FN6O — CID 118159658
[5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea (PubChem CID 118159658) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is [5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea.
| Compound Name | [5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea |
|---|---|
| PubChem CID | 118159658 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]urea |
| SMILES | Cc1cc2c(cc(NC(N)=O)c3nnc(C)n32)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN6O/c1-10-7-16-15(24(10)9-12-3-5-13(19)6-4-12)8-14(21-18(20)26)17-23-22-11(2)25(16)17/h3-8H,9H2,1-2H3,(H3,20,21,26) |
| InChIKey | BPSOOJSJFOVHMV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |