C18H19N5 — CID 118188894
[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methanamine (PubChem CID 118188894) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methanamine.
| Compound Name | [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 118188894 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methanamine |
| SMILES | Cc1cc2c(ccc3nnc(C)n32)n1Cc1cccc(CN)c1 |
| InChI | InChI=1S/C18H19N5/c1-12-8-17-16(6-7-18-21-20-13(2)23(17)18)22(12)11-15-5-3-4-14(9-15)10-19/h3-9H,10-11,19H2,1-2H3 |
| InChIKey | NMDFUXGAZUXRKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |