About bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane
bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane (PubChem CID 158660791) has the molecular formula C39H87P3
and a molecular weight of 649.05 g/mol. Its IUPAC name is bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane.
Molecular Properties
| Compound Name | bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane |
| PubChem CID | 158660791 |
| Molecular Formula | C39H87P3 |
| Molecular Weight | 649.05 g/mol |
| Exact Mass | 648.60 |
| IUPAC Name | bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane |
| SMILES | CCCCCC(C)PC(CC)CCCCC.CCCCCC(C)PC(CC)CCCCC.CCCCCC(CC)PC |
| InChI | InChI=1S/2C15H33P.C9H21P/c2*1-5-8-10-12-14(4)16-15(7-3)13-11-9-6-2;1-4-6-7-8-9(5-2)10-3/h2*14-16H,5-13H2,1-4H3;9-10H,4-8H2,1-3H3 |
| InChIKey | ICSRCFCBUOQIMQ-UHFFFAOYSA-N |
| XLogP | 15.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.05 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane?
The IUPAC name of bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane (CID 158660791) is bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane.
What is the SMILES notation for bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane?
The canonical SMILES for bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane is CCCCCC(C)PC(CC)CCCCC.CCCCCC(C)PC(CC)CCCCC.CCCCCC(CC)PC.
What is the InChIKey of bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane?
The InChIKey is ICSRCFCBUOQIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H33P.C9H21P/c2*1-5-8-10-12-14(4)16-15(7-3)13-11-9-6-2;1-4-6-7-8-9(5-2)10-3/h2*14-16H,5-13H2,1-4H3;9-10H,4-8H2,1-3H3.
What are the key properties of bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane?
bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane has a molecular weight of 649.05 g/mol, XLogP of 15.64, 28 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(heptan-2-yl(octan-3-yl)phosphane);methyl(octan-3-yl)phosphane is sourced from PubChem (CID 158660791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).