C53H113N4+3 — CID 158667378
3-[ethyl(methyl)amino]propyl-methyl-[2-[methyl-octadec-9-enyl-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(Z)-octadec-9-enyl]azanium;methane (PubChem CID 158667378) has the molecular formula C53H113N4+3 and a molecular weight of 806.51 g/mol. Its IUPAC name is 3-[ethyl(methyl)amino]propyl-methyl-[2-[methyl-octadec-9-enyl-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(Z)-octadec-9-enyl]azanium;methane.
| Compound Name | 3-[ethyl(methyl)amino]propyl-methyl-[2-[methyl-octadec-9-enyl-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(Z)-octadec-9-enyl]azanium;methane |
|---|---|
| PubChem CID | 158667378 |
| Molecular Formula | C53H113N4+3 |
| Molecular Weight | 806.51 g/mol |
| Exact Mass | 805.89 |
| IUPAC Name | 3-[ethyl(methyl)amino]propyl-methyl-[2-[methyl-octadec-9-enyl-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(Z)-octadec-9-enyl]azanium;methane |
| SMILES | C.CCCCCCCCC=CCCCCCCCC[N+](C)(CCC[N+](C)(C)C)CC[N+](C)(CCCCCCCC/C=C\CCCCCCCC)CCCN(C)CC |
| InChI | InChI=1S/C52H109N4.CH4/c1-10-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-47-55(8,49-43-45-53(4)12-3)51-52-56(9,50-44-46-54(5,6)7)48-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-11-2;/h25-28H,10-24,29-52H2,1-9H3;1H4/q+3;/b27-25-,28-26?; |
| InChIKey | CBTCURXKLRNNEZ-SGJRNQJHSA-N |
| XLogP | 15.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.51 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|