C52H109N4+3 — CID 88917827
4-(dimethylamino)butyl-methyl-[2-[methyl-[(E)-octadec-9-enyl]-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(E)-octadec-9-enyl]azanium (PubChem CID 88917827) has the molecular formula C52H109N4+3 and a molecular weight of 790.47 g/mol. Its IUPAC name is 4-(dimethylamino)butyl-methyl-[2-[methyl-[(E)-octadec-9-enyl]-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(E)-octadec-9-enyl]azanium.
| Compound Name | 4-(dimethylamino)butyl-methyl-[2-[methyl-[(E)-octadec-9-enyl]-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(E)-octadec-9-enyl]azanium |
|---|---|
| PubChem CID | 88917827 |
| Molecular Formula | C52H109N4+3 |
| Molecular Weight | 790.47 g/mol |
| Exact Mass | 789.86 |
| IUPAC Name | 4-(dimethylamino)butyl-methyl-[2-[methyl-[(E)-octadec-9-enyl]-[3-(trimethylazaniumyl)propyl]azaniumyl]ethyl]-[(E)-octadec-9-enyl]azanium |
| SMILES | CCCCCCCC/C=C/CCCCCCCC[N+](C)(CCCCN(C)C)CC[N+](C)(CCCCCCCC/C=C/CCCCCCCC)CCC[N+](C)(C)C |
| InChI | InChI=1S/C52H109N4/c1-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-41-47-55(8,49-43-40-45-53(3)4)51-52-56(9,50-44-46-54(5,6)7)48-42-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-2/h24-27H,10-23,28-52H2,1-9H3/q+3/b26-24+,27-25+ |
| InChIKey | GKAHAJCAIAYMMN-OWUYFMIJSA-N |
| XLogP | 14.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.47 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|