C43H88N2O2PS+ — CID 53350089
3-[bis[(Z)-octadec-9-enoxy]phosphinothioyl-methylamino]propyl-trimethylazanium (PubChem CID 53350089) has the molecular formula C43H88N2O2PS+ and a molecular weight of 728.23 g/mol. Its IUPAC name is 3-[bis[(Z)-octadec-9-enoxy]phosphinothioyl-methylamino]propyl-trimethylazanium.
| Compound Name | 3-[bis[(Z)-octadec-9-enoxy]phosphinothioyl-methylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 53350089 |
| Molecular Formula | C43H88N2O2PS+ |
| Molecular Weight | 728.23 g/mol |
| Exact Mass | 727.63 |
| IUPAC Name | 3-[bis[(Z)-octadec-9-enoxy]phosphinothioyl-methylamino]propyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=S)(OCCCCCCCC/C=C\CCCCCCCC)N(C)CCC[N+](C)(C)C |
| InChI | InChI=1S/C43H88N2O2PS/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42-46-48(49,44(3)40-39-41-45(4,5)6)47-43-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24H,7-20,25-43H2,1-6H3/q+1/b23-21-,24-22- |
| InChIKey | ICFPFGUCBBOPPQ-SXAUZNKPSA-N |
| XLogP | 14.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.23 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|