C43H47N7O2 — CID 158669290
1,4-bis(6-azidohexoxy)benzene;4-ethynyl-N,N-bis(4-ethynylphenyl)aniline;methane (PubChem CID 158669290) has the molecular formula C43H47N7O2 and a molecular weight of 693.90 g/mol. Its IUPAC name is 1,4-bis(6-azidohexoxy)benzene;4-ethynyl-N,N-bis(4-ethynylphenyl)aniline;methane.
| Compound Name | 1,4-bis(6-azidohexoxy)benzene;4-ethynyl-N,N-bis(4-ethynylphenyl)aniline;methane |
|---|---|
| PubChem CID | 158669290 |
| Molecular Formula | C43H47N7O2 |
| Molecular Weight | 693.90 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | 1,4-bis(6-azidohexoxy)benzene;4-ethynyl-N,N-bis(4-ethynylphenyl)aniline;methane |
| SMILES | C.C#Cc1ccc(N(c2ccc(C#C)cc2)c2ccc(C#C)cc2)cc1.[N-]=[N+]=NCCCCCCOc1ccc(OCCCCCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C24H15N.C18H28N6O2.CH4/c1-4-19-7-13-22(14-8-19)25(23-15-9-20(5-2)10-16-23)24-17-11-21(6-3)12-18-24;19-23-21-13-5-1-3-7-15-25-17-9-11-18(12-10-17)26-16-8-4-2-6-14-22-24-20;/h1-3,7-18H;9-12H,1-8,13-16H2;1H4 |
| InChIKey | IDTBMBPOKOHQND-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 119.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.90 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|