C21H23N3O — CID 138973588
2-[(E)-2-[4-(4-azidobutoxy)phenyl]ethenyl]-2,3-dihydro-1H-indene (PubChem CID 138973588) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4-azidobutoxy)phenyl]ethenyl]-2,3-dihydro-1H-indene.
| Compound Name | 2-[(E)-2-[4-(4-azidobutoxy)phenyl]ethenyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 138973588 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[(E)-2-[4-(4-azidobutoxy)phenyl]ethenyl]-2,3-dihydro-1H-indene |
| SMILES | [N-]=[N+]=NCCCCOc1ccc(/C=C/C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H23N3O/c22-24-23-13-3-4-14-25-21-11-9-17(10-12-21)7-8-18-15-19-5-1-2-6-20(19)16-18/h1-2,5-12,18H,3-4,13-16H2/b8-7+ |
| InChIKey | GVZWHMXIQJTOJQ-BQYQJAHWSA-N |
| XLogP | 5.58 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|