C25H25Cl2N3O6 — CID 158671600
tert-butyl N-[2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethyl]carbamate;5-(2-chlorophenyl)-1,2-oxazol-3-one (PubChem CID 158671600) has the molecular formula C25H25Cl2N3O6 and a molecular weight of 534.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethyl]carbamate;5-(2-chlorophenyl)-1,2-oxazol-3-one.
| Compound Name | tert-butyl N-[2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethyl]carbamate;5-(2-chlorophenyl)-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 158671600 |
| Molecular Formula | C25H25Cl2N3O6 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | tert-butyl N-[2-[[5-(2-chlorophenyl)-1,2-oxazol-3-yl]oxy]ethyl]carbamate;5-(2-chlorophenyl)-1,2-oxazol-3-one |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(-c2ccccc2Cl)on1.O=c1cc(-c2ccccc2Cl)o[nH]1 |
| InChI | InChI=1S/C16H19ClN2O4.C9H6ClNO2/c1-16(2,3)22-15(20)18-8-9-21-14-10-13(23-19-14)11-6-4-5-7-12(11)17;10-7-4-2-1-3-6(7)8-5-9(12)11-13-8/h4-7,10H,8-9H2,1-3H3,(H,18,20);1-5H,(H,11,12) |
| InChIKey | IEAFDHAIASYEMN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|