About 1-benzyl-5-nitroindazole;5-nitro-1H-indazole
1-benzyl-5-nitroindazole;5-nitro-1H-indazole (PubChem CID 158674286) has the molecular formula C21H16N6O4
and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-benzyl-5-nitroindazole;5-nitro-1H-indazole.
Molecular Properties
| Compound Name | 1-benzyl-5-nitroindazole;5-nitro-1H-indazole |
| PubChem CID | 158674286 |
| Molecular Formula | C21H16N6O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-benzyl-5-nitroindazole;5-nitro-1H-indazole |
| SMILES | O=[N+]([O-])c1ccc2[nH]ncc2c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H11N3O2.C7H5N3O2/c18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11;11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-9H,10H2;1-4H,(H,8,9) |
| InChIKey | IEIBGCPOFPYGLT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-nitroindazole;5-nitro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-nitroindazole;5-nitro-1H-indazole?
The IUPAC name of 1-benzyl-5-nitroindazole;5-nitro-1H-indazole (CID 158674286) is 1-benzyl-5-nitroindazole;5-nitro-1H-indazole.
What is the SMILES notation for 1-benzyl-5-nitroindazole;5-nitro-1H-indazole?
The canonical SMILES for 1-benzyl-5-nitroindazole;5-nitro-1H-indazole is O=[N+]([O-])c1ccc2[nH]ncc2c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-5-nitroindazole;5-nitro-1H-indazole?
The InChIKey is IEIBGCPOFPYGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2.C7H5N3O2/c18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11;11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-9H,10H2;1-4H,(H,8,9).
What are the key properties of 1-benzyl-5-nitroindazole;5-nitro-1H-indazole?
1-benzyl-5-nitroindazole;5-nitro-1H-indazole has a molecular weight of 416.40 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-nitroindazole;5-nitro-1H-indazole is sourced from PubChem (CID 158674286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).