C45H53BBr2O7 — CID 158680845
3,5-bis[4-(3-hydroxypropyl)phenyl]phenol;3,5-dibromophenol;3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol (PubChem CID 158680845) has the molecular formula C45H53BBr2O7 and a molecular weight of 876.53 g/mol. Its IUPAC name is 3,5-bis[4-(3-hydroxypropyl)phenyl]phenol;3,5-dibromophenol;3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol.
| Compound Name | 3,5-bis[4-(3-hydroxypropyl)phenyl]phenol;3,5-dibromophenol;3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 158680845 |
| Molecular Formula | C45H53BBr2O7 |
| Molecular Weight | 876.53 g/mol |
| Exact Mass | 874.23 |
| IUPAC Name | 3,5-bis[4-(3-hydroxypropyl)phenyl]phenol;3,5-dibromophenol;3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol |
| SMILES | CC1(C)OB(c2ccc(CCCO)cc2)OC1(C)C.OCCCc1ccc(-c2cc(O)cc(-c3ccc(CCCO)cc3)c2)cc1.Oc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C24H26O3.C15H23BO3.C6H4Br2O/c25-13-1-3-18-5-9-20(10-6-18)22-15-23(17-24(27)16-22)21-11-7-19(8-12-21)4-2-14-26;1-14(2)15(3,4)19-16(18-14)13-9-7-12(8-10-13)6-5-11-17;7-4-1-5(8)3-6(9)2-4/h5-12,15-17,25-27H,1-4,13-14H2;7-10,17H,5-6,11H2,1-4H3;1-3,9H |
| InChIKey | IFCKZSSSGCRIPQ-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.53 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|