C15H30N4 — CID 158683468
1-piperidin-4-ylpiperidine;2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 158683468) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-piperidin-4-ylpiperidine;2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 1-piperidin-4-ylpiperidine;2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 158683468 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | 1-piperidin-4-ylpiperidine;2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C1CCN(C2CCNCC2)CC1.NC1=NCCCC1 |
| InChI | InChI=1S/C10H20N2.C5H10N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10;6-5-3-1-2-4-7-5/h10-11H,1-9H2;1-4H2,(H2,6,7) |
| InChIKey | IFKXMXYSZXULKN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |