C7H10N2O3 — CID 15868501
(2R,3S,4R)-2-(1H-imidazol-5-yl)oxolane-3,4-diol (PubChem CID 15868501) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is (2R,3S,4R)-2-(1H-imidazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(1H-imidazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 15868501 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (2R,3S,4R)-2-(1H-imidazol-5-yl)oxolane-3,4-diol |
| SMILES | O[C@H]1[C@H](O)CO[C@@H]1c1cnc[nH]1 |
| InChI | InChI=1S/C7H10N2O3/c10-5-2-12-7(6(5)11)4-1-8-3-9-4/h1,3,5-7,10-11H,2H2,(H,8,9)/t5-,6+,7-/m1/s1 |
| InChIKey | WNWOCVIKNQCVTO-DSYKOEDSSA-N |
| XLogP | -0.80 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |