C14H10FNO2S — CID 158685533
(3E)-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione (PubChem CID 158685533) has the molecular formula C14H10FNO2S and a molecular weight of 275.30 g/mol. Its IUPAC name is (3E)-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione.
| Compound Name | (3E)-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione |
|---|---|
| PubChem CID | 158685533 |
| Molecular Formula | C14H10FNO2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (3E)-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione |
| SMILES | O=C1CC(=S)NC(=O)/C1=C/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C14H10FNO2S/c15-10-5-1-3-9(7-10)4-2-6-11-12(17)8-13(19)16-14(11)18/h1-7H,8H2,(H,16,18,19)/b4-2+,11-6+ |
| InChIKey | PSKAIVAWLLJTQM-OSVHTFQYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|