C28H22F2N4O6 — CID 144530673
(5E)-1-ethyl-5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione;5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 144530673) has the molecular formula C28H22F2N4O6 and a molecular weight of 548.50 g/mol. Its IUPAC name is (5E)-1-ethyl-5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione;5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-ethyl-5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione;5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144530673 |
| Molecular Formula | C28H22F2N4O6 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (5E)-1-ethyl-5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione;5-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)NC(=O)/C(=C\C=C\c2cccc(F)c2)C1=O.O=C1NC(=O)C(=C/C=C/c2cccc(F)c2)C(=O)N1 |
| InChI | InChI=1S/C15H13FN2O3.C13H9FN2O3/c1-2-18-14(20)12(13(19)17-15(18)21)8-4-6-10-5-3-7-11(16)9-10;14-9-5-1-3-8(7-9)4-2-6-10-11(17)15-13(19)16-12(10)18/h3-9H,2H2,1H3,(H,17,19,21);1-7H,(H2,15,16,17,18,19)/b6-4+,12-8+;4-2+ |
| InChIKey | IEMFZISCROFEOS-AAECHBQMSA-N |
| XLogP | 2.99 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|