C16H14FNO2S — CID 158685536
(3E)-1-ethyl-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione (PubChem CID 158685536) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is (3E)-1-ethyl-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione.
| Compound Name | (3E)-1-ethyl-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione |
|---|---|
| PubChem CID | 158685536 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (3E)-1-ethyl-3-[(E)-3-(3-fluorophenyl)prop-2-enylidene]-6-sulfanylidenepiperidine-2,4-dione |
| SMILES | CCN1C(=O)/C(=C/C=C/c2cccc(F)c2)C(=O)CC1=S |
| InChI | InChI=1S/C16H14FNO2S/c1-2-18-15(21)10-14(19)13(16(18)20)8-4-6-11-5-3-7-12(17)9-11/h3-9H,2,10H2,1H3/b6-4+,13-8+ |
| InChIKey | QIULPULGFQEARB-HDZFOZLDSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|