C27H28F6NO2S2+ — CID 158692383
1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperidine;triphenylsulfanium (PubChem CID 158692383) has the molecular formula C27H28F6NO2S2+ and a molecular weight of 576.65 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperidine;triphenylsulfanium.
| Compound Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperidine;triphenylsulfanium |
|---|---|
| PubChem CID | 158692383 |
| Molecular Formula | C27H28F6NO2S2+ |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperidine;triphenylsulfanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H13F6NO2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(10,11)8(12,13)9(14,15)19(17,18)16-5-3-2-4-6-16/h1-15H;2-6H2,1H3/q+1; |
| InChIKey | IGNAJRSJAHRECT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|