About tribromorhodium;triphenylphosphane
tribromorhodium;triphenylphosphane (PubChem CID 158693880) has the molecular formula C18H15Br3PRh
and a molecular weight of 604.91 g/mol. Its IUPAC name is tribromorhodium;triphenylphosphane.
Molecular Properties
| Compound Name | tribromorhodium;triphenylphosphane |
| PubChem CID | 158693880 |
| Molecular Formula | C18H15Br3PRh |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 601.75 |
| IUPAC Name | tribromorhodium;triphenylphosphane |
| SMILES | Br[Rh](Br)Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.3BrH.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;3*1H;/q;;;;+3/p-3 |
| InChIKey | IGRQEHUYLQNRDY-UHFFFAOYSA-K |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tribromorhodium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribromorhodium;triphenylphosphane?
The IUPAC name of tribromorhodium;triphenylphosphane (CID 158693880) is tribromorhodium;triphenylphosphane.
What is the SMILES notation for tribromorhodium;triphenylphosphane?
The canonical SMILES for tribromorhodium;triphenylphosphane is Br[Rh](Br)Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tribromorhodium;triphenylphosphane?
The InChIKey is IGRQEHUYLQNRDY-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H15P.3BrH.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;3*1H;/q;;;;+3/p-3.
What are the key properties of tribromorhodium;triphenylphosphane?
tribromorhodium;triphenylphosphane has a molecular weight of 604.91 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tribromorhodium;triphenylphosphane is sourced from PubChem (CID 158693880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).