C62H56O12 — CID 158695408
2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-hexylfuran;2,5-bis[5-(furan-2-yl)furan-2-yl]-3-octylfuran (PubChem CID 158695408) has the molecular formula C62H56O12 and a molecular weight of 993.12 g/mol. Its IUPAC name is 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-hexylfuran;2,5-bis[5-(furan-2-yl)furan-2-yl]-3-octylfuran.
| Compound Name | 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-hexylfuran;2,5-bis[5-(furan-2-yl)furan-2-yl]-3-octylfuran |
|---|---|
| PubChem CID | 158695408 |
| Molecular Formula | C62H56O12 |
| Molecular Weight | 993.12 g/mol |
| Exact Mass | 992.38 |
| IUPAC Name | 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-hexylfuran;2,5-bis[5-(furan-2-yl)furan-2-yl]-3-octylfuran |
| SMILES | CCCCCCCCc1cc(-c2ccc(-c3ccco3)o2)oc1-c1ccc(-c2ccco2)o1.CCCCCCc1cc(-c2ccc(-c3ccc(-c4ccco4)o3)o2)oc1-c1ccc(-c2ccc(-c3ccco3)o2)o1 |
| InChI | InChI=1S/C34H28O7.C28H28O5/c1-2-3-4-5-8-22-21-33(31-16-15-28(39-31)27-13-11-25(37-27)23-9-6-19-35-23)41-34(22)32-18-17-30(40-32)29-14-12-26(38-29)24-10-7-20-36-24;1-2-3-4-5-6-7-10-20-19-27(25-14-13-23(31-25)21-11-8-17-29-21)33-28(20)26-16-15-24(32-26)22-12-9-18-30-22/h6-7,9-21H,2-5,8H2,1H3;8-9,11-19H,2-7,10H2,1H3 |
| InChIKey | IGWKVOQQDIYVTM-UHFFFAOYSA-N |
| XLogP | 20.18 |
| TPSA | 157.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.12 |
| LogP ≤ 5 | 20.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|