C36H32O7 — CID 90250758
2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-octylfuran (PubChem CID 90250758) has the molecular formula C36H32O7 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-octylfuran.
| Compound Name | 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-octylfuran |
|---|---|
| PubChem CID | 90250758 |
| Molecular Formula | C36H32O7 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2,5-bis[5-[5-(furan-2-yl)furan-2-yl]furan-2-yl]-3-octylfuran |
| SMILES | CCCCCCCCc1cc(-c2ccc(-c3ccc(-c4ccco4)o3)o2)oc1-c1ccc(-c2ccc(-c3ccco3)o2)o1 |
| InChI | InChI=1S/C36H32O7/c1-2-3-4-5-6-7-10-24-23-35(33-18-17-30(41-33)29-15-13-27(39-29)25-11-8-21-37-25)43-36(24)34-20-19-32(42-34)31-16-14-28(40-31)26-12-9-22-38-26/h8-9,11-23H,2-7,10H2,1H3 |
| InChIKey | CLGUEHYLSNHAPJ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 91.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|