C22H22N6O2 — CID 158695570
1-[4-(5-cyclopropyl-6-pyridin-2-yl-7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid (PubChem CID 158695570) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[4-(5-cyclopropyl-6-pyridin-2-yl-7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid.
| Compound Name | 1-[4-(5-cyclopropyl-6-pyridin-2-yl-7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158695570 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[4-(5-cyclopropyl-6-pyridin-2-yl-7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCCCc2cc3c(nn2)CC(c2ccccn2)=C3C2CC2)nn1 |
| InChI | InChI=1S/C22H22N6O2/c29-22(30)20-13-28(27-26-20)10-4-2-5-15-11-16-19(25-24-15)12-17(21(16)14-7-8-14)18-6-1-3-9-23-18/h1,3,6,9,11,13-14H,2,4-5,7-8,10,12H2,(H,29,30) |
| InChIKey | HGMNTQKROSEGQI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|