C14H15N5O2 — CID 158492168
1-[4-(7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid (PubChem CID 158492168) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[4-(7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid.
| Compound Name | 1-[4-(7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158492168 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[4-(7H-cyclopenta[c]pyridazin-3-yl)butyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCCCc2cc3c(nn2)CC=C3)nn1 |
| InChI | InChI=1S/C14H15N5O2/c20-14(21)13-9-19(18-17-13)7-2-1-5-11-8-10-4-3-6-12(10)16-15-11/h3-4,8-9H,1-2,5-7H2,(H,20,21) |
| InChIKey | NZYAOFKEYKEWEY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|