C19H38N+ — CID 158696241
3,3-dimethylbutyl-[(4-ethylphenyl)methyl]-dimethylazanium;methane (PubChem CID 158696241) has the molecular formula C19H38N+ and a molecular weight of 280.52 g/mol. Its IUPAC name is 3,3-dimethylbutyl-[(4-ethylphenyl)methyl]-dimethylazanium;methane.
| Compound Name | 3,3-dimethylbutyl-[(4-ethylphenyl)methyl]-dimethylazanium;methane |
|---|---|
| PubChem CID | 158696241 |
| Molecular Formula | C19H38N+ |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.30 |
| IUPAC Name | 3,3-dimethylbutyl-[(4-ethylphenyl)methyl]-dimethylazanium;methane |
| SMILES | C.C.CCc1ccc(C[N+](C)(C)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H30N.2CH4/c1-7-15-8-10-16(11-9-15)14-18(5,6)13-12-17(2,3)4;;/h8-11H,7,12-14H2,1-6H3;2*1H4/q+1;; |
| InChIKey | IGZDJXPAWLOLJP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|