C23H38N3O8P3S2 — CID 158702669
3-[[3-[3-[(2R,5R)-4-hydroxy-5-(triphosphanyloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]-3-oxopropyl]disulfanyl]-N-(6-oxooctyl)propanamide (PubChem CID 158702669) has the molecular formula C23H38N3O8P3S2 and a molecular weight of 641.63 g/mol. Its IUPAC name is 3-[[3-[3-[(2R,5R)-4-hydroxy-5-(triphosphanyloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]-3-oxopropyl]disulfanyl]-N-(6-oxooctyl)propanamide.
| Compound Name | 3-[[3-[3-[(2R,5R)-4-hydroxy-5-(triphosphanyloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]-3-oxopropyl]disulfanyl]-N-(6-oxooctyl)propanamide |
|---|---|
| PubChem CID | 158702669 |
| Molecular Formula | C23H38N3O8P3S2 |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | 3-[[3-[3-[(2R,5R)-4-hydroxy-5-(triphosphanyloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]-3-oxopropyl]disulfanyl]-N-(6-oxooctyl)propanamide |
| SMILES | CCC(=O)CCCCCNC(=O)CCSSCCC(=O)n1c(=O)ccn([C@H]2CC(O)[C@@H](COPPP)O2)c1=O |
| InChI | InChI=1S/C23H38N3O8P3S2/c1-2-16(27)6-4-3-5-10-24-19(29)8-12-38-39-13-9-21(31)26-20(30)7-11-25(23(26)32)22-14-17(28)18(34-22)15-33-36-37-35/h7,11,17-18,22,28,36-37H,2-6,8-10,12-15,35H2,1H3,(H,24,29)/t17?,18-,22-/m1/s1 |
| InChIKey | GUFVHDPNEISHPN-WMISUKIASA-N |
| XLogP | 3.11 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|