C15H25N2O14P3S2 — CID 121406060
[hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[4-[4-(methyldisulfanyl)butanoylamino]-2-oxo-1-pyridinyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 121406060) has the molecular formula C15H25N2O14P3S2 and a molecular weight of 614.42 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[4-[4-(methyldisulfanyl)butanoylamino]-2-oxo-1-pyridinyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[4-[4-(methyldisulfanyl)butanoylamino]-2-oxo-1-pyridinyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121406060 |
| Molecular Formula | C15H25N2O14P3S2 |
| Molecular Weight | 614.42 g/mol |
| Exact Mass | 614.00 |
| IUPAC Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[4-[4-(methyldisulfanyl)butanoylamino]-2-oxo-1-pyridinyl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CSSCCCC(=O)Nc1ccn([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)c1 |
| InChI | InChI=1S/C15H25N2O14P3S2/c1-35-36-6-2-3-13(19)16-10-4-5-17(14(20)7-10)15-8-11(18)12(29-15)9-28-33(24,25)31-34(26,27)30-32(21,22)23/h4-5,7,11-12,15,18H,2-3,6,8-9H2,1H3,(H,16,19)(H,24,25)(H,26,27)(H2,21,22,23)/t11-,12-,15-/m1/s1 |
| InChIKey | DKAOLTSUBMNSCJ-LALPHHSUSA-N |
| XLogP | 1.57 |
| TPSA | 240.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|