C25H42N5O11PS2 — CID 59806218
[5-[3-[2-[6-[[2-acetamido-2-(tert-butyldisulfanyl)acetyl]amino]hexanoylamino]ethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 59806218) has the molecular formula C25H42N5O11PS2 and a molecular weight of 683.74 g/mol. Its IUPAC name is [5-[3-[2-[6-[[2-acetamido-2-(tert-butyldisulfanyl)acetyl]amino]hexanoylamino]ethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-[3-[2-[6-[[2-acetamido-2-(tert-butyldisulfanyl)acetyl]amino]hexanoylamino]ethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59806218 |
| Molecular Formula | C25H42N5O11PS2 |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | [5-[3-[2-[6-[[2-acetamido-2-(tert-butyldisulfanyl)acetyl]amino]hexanoylamino]ethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)NC(SSC(C)(C)C)C(=O)NCCCCCC(=O)NCCn1c(=O)ccn(C2CC(O)C(COP(=O)(O)O)O2)c1=O |
| InChI | InChI=1S/C25H42N5O11PS2/c1-16(31)28-23(43-44-25(2,3)4)22(35)27-10-7-5-6-8-19(33)26-11-13-29-20(34)9-12-30(24(29)36)21-14-17(32)18(41-21)15-40-42(37,38)39/h9,12,17-18,21,23,32H,5-8,10-11,13-15H2,1-4H3,(H,26,33)(H,27,35)(H,28,31)(H2,37,38,39) |
| InChIKey | DOPJBKOTJFEYEF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 227.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|