C35H36N2O7 — CID 91201192
1-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-3-pent-4-ynylpyrimidine-2,4-dione (PubChem CID 91201192) has the molecular formula C35H36N2O7 and a molecular weight of 596.68 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-3-pent-4-ynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-3-pent-4-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91201192 |
| Molecular Formula | C35H36N2O7 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 1-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-3-pent-4-ynylpyrimidine-2,4-dione |
| SMILES | C#CCCCn1c(=O)ccn([C@H]2C[C@@H](O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c1=O |
| InChI | InChI=1S/C35H36N2O7/c1-4-5-9-21-36-32(39)20-22-37(34(36)40)33-23-30(38)31(44-33)24-43-35(25-10-7-6-8-11-25,26-12-16-28(41-2)17-13-26)27-14-18-29(42-3)19-15-27/h1,6-8,10-20,22,30-31,33,38H,5,9,21,23-24H2,2-3H3/t30-,31-,33-/m1/s1 |
| InChIKey | XGOCAJQWGIVAEQ-FMPXFOGJSA-N |
| XLogP | 4.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|