About benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate
benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate (PubChem CID 158703546) has the molecular formula C29H23F3O6
and a molecular weight of 524.49 g/mol. Its IUPAC name is benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate |
| PubChem CID | 158703546 |
| Molecular Formula | C29H23F3O6 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1cccc(O)c1C(F)(F)F.O=C(OCc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C15H11F3O3.C14H12O3/c16-15(17,18)13-11(7-4-8-12(13)19)14(20)21-9-10-5-2-1-3-6-10;15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-8,19H,9H2;1-9,15H,10H2 |
| InChIKey | IHVLYQBHSXSZAL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate?
The IUPAC name of benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate (CID 158703546) is benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate.
What is the SMILES notation for benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate?
The canonical SMILES for benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate is O=C(OCc1ccccc1)c1cccc(O)c1C(F)(F)F.O=C(OCc1ccccc1)c1ccccc1O.
What is the InChIKey of benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate?
The InChIKey is IHVLYQBHSXSZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3O3.C14H12O3/c16-15(17,18)13-11(7-4-8-12(13)19)14(20)21-9-10-5-2-1-3-6-10;15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-8,19H,9H2;1-9,15H,10H2.
What are the key properties of benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate?
benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate has a molecular weight of 524.49 g/mol, XLogP of 6.52, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-hydroxybenzoate;benzyl 3-hydroxy-2-(trifluoromethyl)benzoate is sourced from PubChem (CID 158703546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).