About bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol
bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol (PubChem CID 158716974) has the molecular formula C18H19BrN2O4S2
and a molecular weight of 471.40 g/mol. Its IUPAC name is bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol.
Molecular Properties
| Compound Name | bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol |
| PubChem CID | 158716974 |
| Molecular Formula | C18H19BrN2O4S2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol |
| SMILES | BrC1CC1.O=[N+]([O-])c1ccc(S)cc1.O=[N+]([O-])c1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C9H9NO2S.C6H5NO2S.C3H5Br/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9;8-7(9)5-1-3-6(10)4-2-5;4-3-1-2-3/h1-4,9H,5-6H2;1-4,10H;3H,1-2H2 |
| InChIKey | IJKYCECLKVUOMX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol?
The IUPAC name of bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol (CID 158716974) is bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol.
What is the SMILES notation for bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol?
The canonical SMILES for bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol is BrC1CC1.O=[N+]([O-])c1ccc(S)cc1.O=[N+]([O-])c1ccc(SC2CC2)cc1.
What is the InChIKey of bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol?
The InChIKey is IJKYCECLKVUOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S.C6H5NO2S.C3H5Br/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9;8-7(9)5-1-3-6(10)4-2-5;4-3-1-2-3/h1-4,9H,5-6H2;1-4,10H;3H,1-2H2.
What are the key properties of bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol?
bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol has a molecular weight of 471.40 g/mol, XLogP of 6.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bromocyclopropane;1-cyclopropylsulfanyl-4-nitrobenzene;4-nitrobenzenethiol is sourced from PubChem (CID 158716974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).